C73H88Si2 — CID 15527428
trimethyl-[3,6,9,12,15-pentakis(2-adamantylidene)-17-trimethylsilylheptadeca-1,4,7,10,13,16-hexaynyl]silane (PubChem CID 15527428) has the molecular formula C73H88Si2 and a molecular weight of 1021.68 g/mol. Its IUPAC name is trimethyl-[3,6,9,12,15-pentakis(2-adamantylidene)-17-trimethylsilylheptadeca-1,4,7,10,13,16-hexaynyl]silane.
| Compound Name | trimethyl-[3,6,9,12,15-pentakis(2-adamantylidene)-17-trimethylsilylheptadeca-1,4,7,10,13,16-hexaynyl]silane |
|---|---|
| PubChem CID | 15527428 |
| Molecular Formula | C73H88Si2 |
| Molecular Weight | 1021.68 g/mol |
| Exact Mass | 1020.64 |
| IUPAC Name | trimethyl-[3,6,9,12,15-pentakis(2-adamantylidene)-17-trimethylsilylheptadeca-1,4,7,10,13,16-hexaynyl]silane |
| SMILES | C[Si](C)(C)C#CC(C#CC(C#CC(C#CC(C#CC(C#C[Si](C)(C)C)=C1C2CC3CC(C2)CC1C3)=C1C2CC3CC(C2)CC1C3)=C1C2CC3CC(C2)CC1C3)=C1C2CC3CC(C2)CC1C3)=C1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C73H88Si2/c1-74(2,3)17-15-57(72-65-36-50-22-51(38-65)39-66(72)37-50)13-11-55(70-61-28-46-20-47(30-61)31-62(70)29-46)9-7-54(69-59-24-44-19-45(26-59)27-60(69)25-44)8-10-56(71-63-32-48-21-49(34-63)35-64(71)33-48)12-14-58(16-18-75(4,5)6)73-67-40-52-23-53(42-67)43-68(73)41-52/h44-53,59-68H,19-43H2,1-6H3/b69-54?,70-55-,71-56-,72-57-,73-58- |
| InChIKey | BVDBXEOTARIHAL-YNNINGCRSA-N |
| XLogP | 16.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1021.68 |
| LogP ≤ 5 | 16.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|