C18H28Si2 — CID 10685655
trimethyl-[2-[3-(2-trimethylsilylethynyl)-2-bicyclo[2.2.2]oct-2-enyl]ethynyl]silane (PubChem CID 10685655) has the molecular formula C18H28Si2 and a molecular weight of 300.59 g/mol. Its IUPAC name is trimethyl-[2-[3-(2-trimethylsilylethynyl)-2-bicyclo[2.2.2]oct-2-enyl]ethynyl]silane.
| Compound Name | trimethyl-[2-[3-(2-trimethylsilylethynyl)-2-bicyclo[2.2.2]oct-2-enyl]ethynyl]silane |
|---|---|
| PubChem CID | 10685655 |
| Molecular Formula | C18H28Si2 |
| Molecular Weight | 300.59 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | trimethyl-[2-[3-(2-trimethylsilylethynyl)-2-bicyclo[2.2.2]oct-2-enyl]ethynyl]silane |
| SMILES | C[Si](C)(C)C#CC1=C(C#C[Si](C)(C)C)C2CCC1CC2 |
| InChI | InChI=1S/C18H28Si2/c1-19(2,3)13-11-17-15-7-9-16(10-8-15)18(17)12-14-20(4,5)6/h15-16H,7-10H2,1-6H3 |
| InChIKey | RYWRMQAJPZEZOT-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.59 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|