C25H42Si — CID 10571233
trimethyl-[3-[(2Z)-2-tridec-5-yn-7-ylidenecyclohexyl]prop-1-ynyl]silane (PubChem CID 10571233) has the molecular formula C25H42Si and a molecular weight of 370.70 g/mol. Its IUPAC name is trimethyl-[3-[(2Z)-2-tridec-5-yn-7-ylidenecyclohexyl]prop-1-ynyl]silane.
| Compound Name | trimethyl-[3-[(2Z)-2-tridec-5-yn-7-ylidenecyclohexyl]prop-1-ynyl]silane |
|---|---|
| PubChem CID | 10571233 |
| Molecular Formula | C25H42Si |
| Molecular Weight | 370.70 g/mol |
| Exact Mass | 370.31 |
| IUPAC Name | trimethyl-[3-[(2Z)-2-tridec-5-yn-7-ylidenecyclohexyl]prop-1-ynyl]silane |
| SMILES | CCCCC#C/C(CCCCCC)=C1/CCCCC1CC#C[Si](C)(C)C |
| InChI | InChI=1S/C25H42Si/c1-6-8-10-12-17-23(18-13-11-9-7-2)25-21-15-14-19-24(25)20-16-22-26(3,4)5/h24H,6-12,14-15,17,19-21H2,1-5H3/b25-23- |
| InChIKey | JWNSNPZKMLZCRL-BZZOAKBMSA-N |
| XLogP | 7.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.70 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|