C23H42Si — CID 135007250
tert-butyl-[1-(4-tert-butylcyclohexylidene)hept-2-ynyl]-dimethylsilane (PubChem CID 135007250) has the molecular formula C23H42Si and a molecular weight of 346.68 g/mol. Its IUPAC name is tert-butyl-[1-(4-tert-butylcyclohexylidene)hept-2-ynyl]-dimethylsilane.
| Compound Name | tert-butyl-[1-(4-tert-butylcyclohexylidene)hept-2-ynyl]-dimethylsilane |
|---|---|
| PubChem CID | 135007250 |
| Molecular Formula | C23H42Si |
| Molecular Weight | 346.68 g/mol |
| Exact Mass | 346.31 |
| IUPAC Name | tert-butyl-[1-(4-tert-butylcyclohexylidene)hept-2-ynyl]-dimethylsilane |
| SMILES | CCCCC#CC(=C1CCC(C(C)(C)C)CC1)[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H42Si/c1-10-11-12-13-14-21(24(8,9)23(5,6)7)19-15-17-20(18-16-19)22(2,3)4/h20H,10-12,15-18H2,1-9H3/b21-19- |
| InChIKey | BMXORDCAJPEYFM-VZCXRCSSSA-N |
| XLogP | 7.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.68 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|