C19H40Si2 — CID 102154705
[2-(4-tert-butylcyclohexylidene)-3-trimethylsilylpropyl]-trimethylsilane (PubChem CID 102154705) has the molecular formula C19H40Si2 and a molecular weight of 324.70 g/mol. Its IUPAC name is [2-(4-tert-butylcyclohexylidene)-3-trimethylsilylpropyl]-trimethylsilane.
| Compound Name | [2-(4-tert-butylcyclohexylidene)-3-trimethylsilylpropyl]-trimethylsilane |
|---|---|
| PubChem CID | 102154705 |
| Molecular Formula | C19H40Si2 |
| Molecular Weight | 324.70 g/mol |
| Exact Mass | 324.27 |
| IUPAC Name | [2-(4-tert-butylcyclohexylidene)-3-trimethylsilylpropyl]-trimethylsilane |
| SMILES | CC(C)(C)C1CCC(=C(C[Si](C)(C)C)C[Si](C)(C)C)CC1 |
| InChI | InChI=1S/C19H40Si2/c1-19(2,3)18-12-10-16(11-13-18)17(14-20(4,5)6)15-21(7,8)9/h18H,10-15H2,1-9H3 |
| InChIKey | LYDJNBUYFAXIEU-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.70 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|