C17H32Si — CID 101077362
[(E)-4-(4-tert-butylcyclohexylidene)but-2-enyl]-trimethylsilane (PubChem CID 101077362) has the molecular formula C17H32Si and a molecular weight of 264.53 g/mol. Its IUPAC name is [(E)-4-(4-tert-butylcyclohexylidene)but-2-enyl]-trimethylsilane.
| Compound Name | [(E)-4-(4-tert-butylcyclohexylidene)but-2-enyl]-trimethylsilane |
|---|---|
| PubChem CID | 101077362 |
| Molecular Formula | C17H32Si |
| Molecular Weight | 264.53 g/mol |
| Exact Mass | 264.23 |
| IUPAC Name | [(E)-4-(4-tert-butylcyclohexylidene)but-2-enyl]-trimethylsilane |
| SMILES | CC(C)(C)C1CCC(=C/C=C/C[Si](C)(C)C)CC1 |
| InChI | InChI=1S/C17H32Si/c1-17(2,3)16-12-10-15(11-13-16)9-7-8-14-18(4,5)6/h7-9,16H,10-14H2,1-6H3/b8-7+,15-9- |
| InChIKey | ODUVEZSIJSKFCN-YMOMHROCSA-N |
| XLogP | 6.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.53 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|