C20H32 — CID 162851588
(2S)-1,1-dimethyl-3-methylidene-2-[(3E)-3-methyl-7-methylidenenona-3,8-dienyl]cyclohexane (PubChem CID 162851588) has the molecular formula C20H32 and a molecular weight of 272.48 g/mol. Its IUPAC name is (2S)-1,1-dimethyl-3-methylidene-2-[(3E)-3-methyl-7-methylidenenona-3,8-dienyl]cyclohexane.
| Compound Name | (2S)-1,1-dimethyl-3-methylidene-2-[(3E)-3-methyl-7-methylidenenona-3,8-dienyl]cyclohexane |
|---|---|
| PubChem CID | 162851588 |
| Molecular Formula | C20H32 |
| Molecular Weight | 272.48 g/mol |
| Exact Mass | 272.25 |
| IUPAC Name | (2S)-1,1-dimethyl-3-methylidene-2-[(3E)-3-methyl-7-methylidenenona-3,8-dienyl]cyclohexane |
| SMILES | C=CC(=C)CC/C=C(\C)CC[C@@H]1C(=C)CCCC1(C)C |
| InChI | InChI=1S/C20H32/c1-7-16(2)10-8-11-17(3)13-14-19-18(4)12-9-15-20(19,5)6/h7,11,19H,1-2,4,8-10,12-15H2,3,5-6H3/b17-11+/t19-/m1/s1 |
| InChIKey | JYLFEIJIZTXUNT-GTENMVSRSA-N |
| XLogP | 6.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.48 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|