C23H46Si3 — CID 15785487
(1,2-ditert-butyl-6,7-dimethyl-4-trimethylsilyl-4-silaspiro[2.5]octa-1,6-dien-4-yl)-trimethylsilane (PubChem CID 15785487) has the molecular formula C23H46Si3 and a molecular weight of 406.88 g/mol. Its IUPAC name is (1,2-ditert-butyl-6,7-dimethyl-4-trimethylsilyl-4-silaspiro[2.5]octa-1,6-dien-4-yl)-trimethylsilane.
| Compound Name | (1,2-ditert-butyl-6,7-dimethyl-4-trimethylsilyl-4-silaspiro[2.5]octa-1,6-dien-4-yl)-trimethylsilane |
|---|---|
| PubChem CID | 15785487 |
| Molecular Formula | C23H46Si3 |
| Molecular Weight | 406.88 g/mol |
| Exact Mass | 406.29 |
| IUPAC Name | (1,2-ditert-butyl-6,7-dimethyl-4-trimethylsilyl-4-silaspiro[2.5]octa-1,6-dien-4-yl)-trimethylsilane |
| SMILES | CC1=C(C)C[Si]([Si](C)(C)C)([Si](C)(C)C)C2(C1)C(C(C)(C)C)=C2C(C)(C)C |
| InChI | InChI=1S/C23H46Si3/c1-17-15-23(19(21(3,4)5)20(23)22(6,7)8)26(16-18(17)2,24(9,10)11)25(12,13)14/h15-16H2,1-14H3 |
| InChIKey | UAFPSRANYAYOBL-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.88 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|