C19H32Si2 — CID 10881642
[3-(4,4-dimethylcyclohexylidene)-5-trimethylsilylpenta-1,4-diynyl]-trimethylsilane (PubChem CID 10881642) has the molecular formula C19H32Si2 and a molecular weight of 316.64 g/mol. Its IUPAC name is [3-(4,4-dimethylcyclohexylidene)-5-trimethylsilylpenta-1,4-diynyl]-trimethylsilane.
| Compound Name | [3-(4,4-dimethylcyclohexylidene)-5-trimethylsilylpenta-1,4-diynyl]-trimethylsilane |
|---|---|
| PubChem CID | 10881642 |
| Molecular Formula | C19H32Si2 |
| Molecular Weight | 316.64 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | [3-(4,4-dimethylcyclohexylidene)-5-trimethylsilylpenta-1,4-diynyl]-trimethylsilane |
| SMILES | CC1(C)CCC(=C(C#C[Si](C)(C)C)C#C[Si](C)(C)C)CC1 |
| InChI | InChI=1S/C19H32Si2/c1-19(2)13-9-17(10-14-19)18(11-15-20(3,4)5)12-16-21(6,7)8/h9-10,13-14H2,1-8H3 |
| InChIKey | KGFZSBSKVCKILW-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.64 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|