C27H46Si — CID 11475033
8-(4-tert-butylcyclohexen-1-yl)octa-1,7-diynyl-tri(propan-2-yl)silane (PubChem CID 11475033) has the molecular formula C27H46Si and a molecular weight of 398.75 g/mol. Its IUPAC name is 8-(4-tert-butylcyclohexen-1-yl)octa-1,7-diynyl-tri(propan-2-yl)silane.
| Compound Name | 8-(4-tert-butylcyclohexen-1-yl)octa-1,7-diynyl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 11475033 |
| Molecular Formula | C27H46Si |
| Molecular Weight | 398.75 g/mol |
| Exact Mass | 398.34 |
| IUPAC Name | 8-(4-tert-butylcyclohexen-1-yl)octa-1,7-diynyl-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](C#CCCCCC#CC1=CCC(C(C)(C)C)CC1)(C(C)C)C(C)C |
| InChI | InChI=1S/C27H46Si/c1-22(2)28(23(3)4,24(5)6)21-15-13-11-10-12-14-16-25-17-19-26(20-18-25)27(7,8)9/h17,22-24,26H,10-13,18-20H2,1-9H3 |
| InChIKey | GNPBMMDBUCYMFC-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.75 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|