C16H30Si — CID 13280452
[1-(4-tert-butylcyclohexen-1-yl)cyclopropyl]-trimethylsilane (PubChem CID 13280452) has the molecular formula C16H30Si and a molecular weight of 250.50 g/mol. Its IUPAC name is [1-(4-tert-butylcyclohexen-1-yl)cyclopropyl]-trimethylsilane.
| Compound Name | [1-(4-tert-butylcyclohexen-1-yl)cyclopropyl]-trimethylsilane |
|---|---|
| PubChem CID | 13280452 |
| Molecular Formula | C16H30Si |
| Molecular Weight | 250.50 g/mol |
| Exact Mass | 250.21 |
| IUPAC Name | [1-(4-tert-butylcyclohexen-1-yl)cyclopropyl]-trimethylsilane |
| SMILES | CC(C)(C)C1CC=C(C2([Si](C)(C)C)CC2)CC1 |
| InChI | InChI=1S/C16H30Si/c1-15(2,3)13-7-9-14(10-8-13)16(11-12-16)17(4,5)6/h9,13H,7-8,10-12H2,1-6H3 |
| InChIKey | WEQHROCJHKSMDJ-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.50 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|