C15H24Si — CID 164665436
trimethyl-[2-[[(2S)-4-methyl-2-bicyclo[3.1.1]hept-3-enyl]methyl]cyclopropen-1-yl]silane (PubChem CID 164665436) has the molecular formula C15H24Si and a molecular weight of 232.44 g/mol. Its IUPAC name is trimethyl-[2-[[(2S)-4-methyl-2-bicyclo[3.1.1]hept-3-enyl]methyl]cyclopropen-1-yl]silane.
| Compound Name | trimethyl-[2-[[(2S)-4-methyl-2-bicyclo[3.1.1]hept-3-enyl]methyl]cyclopropen-1-yl]silane |
|---|---|
| PubChem CID | 164665436 |
| Molecular Formula | C15H24Si |
| Molecular Weight | 232.44 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | trimethyl-[2-[[(2S)-4-methyl-2-bicyclo[3.1.1]hept-3-enyl]methyl]cyclopropen-1-yl]silane |
| SMILES | CC1=C[C@@H](CC2=C([Si](C)(C)C)C2)C2CC1C2 |
| InChI | InChI=1S/C15H24Si/c1-10-5-12(13-6-11(10)7-13)8-14-9-15(14)16(2,3)4/h5,11-13H,6-9H2,1-4H3/t11?,12-,13?/m0/s1 |
| InChIKey | PQXVNJGMIGDQNN-CPCZMJQVSA-N |
| XLogP | 4.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.44 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|