C22H38Si2 — CID 10760890
trimethyl-(15-trimethylsilyl-5-tricyclo[8.2.2.24,7]hexadeca-1(12),4(16),6-trienyl)silane (PubChem CID 10760890) has the molecular formula C22H38Si2 and a molecular weight of 358.72 g/mol. Its IUPAC name is trimethyl-(15-trimethylsilyl-5-tricyclo[8.2.2.24,7]hexadeca-1(12),4(16),6-trienyl)silane.
| Compound Name | trimethyl-(15-trimethylsilyl-5-tricyclo[8.2.2.24,7]hexadeca-1(12),4(16),6-trienyl)silane |
|---|---|
| PubChem CID | 10760890 |
| Molecular Formula | C22H38Si2 |
| Molecular Weight | 358.72 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | trimethyl-(15-trimethylsilyl-5-tricyclo[8.2.2.24,7]hexadeca-1(12),4(16),6-trienyl)silane |
| SMILES | C[Si](C)(C)C1C=C2CCC3CC=C(CCC1=CC2[Si](C)(C)C)CC3 |
| InChI | InChI=1S/C22H38Si2/c1-23(2,3)21-15-20-14-12-18-9-7-17(8-10-18)11-13-19(21)16-22(20)24(4,5)6/h7,15-16,18,21-22H,8-14H2,1-6H3 |
| InChIKey | BWBJQTXUNBSMPG-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.72 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|