C24H50Si4 — CID 102298564
[(4aS,8aS)-1-(2-methylprop-1-enyl)-3,4,4a,5,6,7,8,8a-octahydronaphthalen-2-yl]methyl-tris(trimethylsilyl)silane (PubChem CID 102298564) has the molecular formula C24H50Si4 and a molecular weight of 451.01 g/mol. Its IUPAC name is [(4aS,8aS)-1-(2-methylprop-1-enyl)-3,4,4a,5,6,7,8,8a-octahydronaphthalen-2-yl]methyl-tris(trimethylsilyl)silane.
| Compound Name | [(4aS,8aS)-1-(2-methylprop-1-enyl)-3,4,4a,5,6,7,8,8a-octahydronaphthalen-2-yl]methyl-tris(trimethylsilyl)silane |
|---|---|
| PubChem CID | 102298564 |
| Molecular Formula | C24H50Si4 |
| Molecular Weight | 451.01 g/mol |
| Exact Mass | 450.30 |
| IUPAC Name | [(4aS,8aS)-1-(2-methylprop-1-enyl)-3,4,4a,5,6,7,8,8a-octahydronaphthalen-2-yl]methyl-tris(trimethylsilyl)silane |
| SMILES | CC(C)=CC1=C(C[Si]([Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C)CC[C@@H]2CCCC[C@H]12 |
| InChI | InChI=1S/C24H50Si4/c1-20(2)18-24-22(17-16-21-14-12-13-15-23(21)24)19-28(25(3,4)5,26(6,7)8)27(9,10)11/h18,21,23H,12-17,19H2,1-11H3/t21-,23-/m0/s1 |
| InChIKey | BAKZDJDYGWTQLG-GMAHTHKFSA-N |
| XLogP | 8.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.01 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|