C19H44Si4 — CID 135003622
trimethyl-[[(4R)-4-propan-2-ylcyclohexen-1-yl]methyl-bis(trimethylsilyl)silyl]silane (PubChem CID 135003622) has the molecular formula C19H44Si4 and a molecular weight of 384.91 g/mol. Its IUPAC name is trimethyl-[[(4R)-4-propan-2-ylcyclohexen-1-yl]methyl-bis(trimethylsilyl)silyl]silane.
| Compound Name | trimethyl-[[(4R)-4-propan-2-ylcyclohexen-1-yl]methyl-bis(trimethylsilyl)silyl]silane |
|---|---|
| PubChem CID | 135003622 |
| Molecular Formula | C19H44Si4 |
| Molecular Weight | 384.91 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | trimethyl-[[(4R)-4-propan-2-ylcyclohexen-1-yl]methyl-bis(trimethylsilyl)silyl]silane |
| SMILES | CC(C)[C@H]1CC=C(C[Si]([Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C)CC1 |
| InChI | InChI=1S/C19H44Si4/c1-17(2)19-14-12-18(13-15-19)16-23(20(3,4)5,21(6,7)8)22(9,10)11/h12,17,19H,13-16H2,1-11H3/t19-/m0/s1 |
| InChIKey | YEYMSESZJRJOSW-IBGZPJMESA-N |
| XLogP | 7.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.91 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|