C22H42Si2 — CID 134832828
[(2S,3R)-2,3-dipropyl-4-trimethylsilyl-2,3,5,6,7,8-hexahydronaphthalen-1-yl]-trimethylsilane (PubChem CID 134832828) has the molecular formula C22H42Si2 and a molecular weight of 362.75 g/mol. Its IUPAC name is [(2S,3R)-2,3-dipropyl-4-trimethylsilyl-2,3,5,6,7,8-hexahydronaphthalen-1-yl]-trimethylsilane.
| Compound Name | [(2S,3R)-2,3-dipropyl-4-trimethylsilyl-2,3,5,6,7,8-hexahydronaphthalen-1-yl]-trimethylsilane |
|---|---|
| PubChem CID | 134832828 |
| Molecular Formula | C22H42Si2 |
| Molecular Weight | 362.75 g/mol |
| Exact Mass | 362.28 |
| IUPAC Name | [(2S,3R)-2,3-dipropyl-4-trimethylsilyl-2,3,5,6,7,8-hexahydronaphthalen-1-yl]-trimethylsilane |
| SMILES | CCC[C@@H]1C([Si](C)(C)C)=C2CCCCC2=C([Si](C)(C)C)[C@@H]1CCC |
| InChI | InChI=1S/C22H42Si2/c1-9-13-17-18(14-10-2)22(24(6,7)8)20-16-12-11-15-19(20)21(17)23(3,4)5/h17-18H,9-16H2,1-8H3/t17-,18+ |
| InChIKey | SJTYVUDYXHSKAO-HDICACEKSA-N |
| XLogP | 7.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.75 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|