C17H32Si2 — CID 134968531
(5-cyclohexyl-4-ethyl-1,1-dimethylsilol-2-yl)-trimethylsilane (PubChem CID 134968531) has the molecular formula C17H32Si2 and a molecular weight of 292.62 g/mol. Its IUPAC name is (5-cyclohexyl-4-ethyl-1,1-dimethylsilol-2-yl)-trimethylsilane.
| Compound Name | (5-cyclohexyl-4-ethyl-1,1-dimethylsilol-2-yl)-trimethylsilane |
|---|---|
| PubChem CID | 134968531 |
| Molecular Formula | C17H32Si2 |
| Molecular Weight | 292.62 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | (5-cyclohexyl-4-ethyl-1,1-dimethylsilol-2-yl)-trimethylsilane |
| SMILES | CCC1=C(C2CCCCC2)[Si](C)(C)C([Si](C)(C)C)=C1 |
| InChI | InChI=1S/C17H32Si2/c1-7-14-13-16(18(2,3)4)19(5,6)17(14)15-11-9-8-10-12-15/h13,15H,7-12H2,1-6H3 |
| InChIKey | KPCUUYNVKJUJJW-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.62 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|