C20H38Si2 — CID 46930671
trimethyl-(5-oct-7-enyl-4-trimethylsilylcyclohexa-1,3-dien-1-yl)silane (PubChem CID 46930671) has the molecular formula C20H38Si2 and a molecular weight of 334.70 g/mol. Its IUPAC name is trimethyl-(5-oct-7-enyl-4-trimethylsilylcyclohexa-1,3-dien-1-yl)silane.
| Compound Name | trimethyl-(5-oct-7-enyl-4-trimethylsilylcyclohexa-1,3-dien-1-yl)silane |
|---|---|
| PubChem CID | 46930671 |
| Molecular Formula | C20H38Si2 |
| Molecular Weight | 334.70 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | trimethyl-(5-oct-7-enyl-4-trimethylsilylcyclohexa-1,3-dien-1-yl)silane |
| SMILES | C=CCCCCCCC1CC([Si](C)(C)C)=CC=C1[Si](C)(C)C |
| InChI | InChI=1S/C20H38Si2/c1-8-9-10-11-12-13-14-18-17-19(21(2,3)4)15-16-20(18)22(5,6)7/h8,15-16,18H,1,9-14,17H2,2-7H3 |
| InChIKey | MIWAOIUTOPOXMP-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.70 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|