C12H22Si — CID 15040722
[(Z)-(3,5-dimethylcyclohex-2-en-1-ylidene)methyl]-trimethylsilane (PubChem CID 15040722) has the molecular formula C12H22Si and a molecular weight of 194.39 g/mol. Its IUPAC name is [(Z)-(3,5-dimethylcyclohex-2-en-1-ylidene)methyl]-trimethylsilane.
| Compound Name | [(Z)-(3,5-dimethylcyclohex-2-en-1-ylidene)methyl]-trimethylsilane |
|---|---|
| PubChem CID | 15040722 |
| Molecular Formula | C12H22Si |
| Molecular Weight | 194.39 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | [(Z)-(3,5-dimethylcyclohex-2-en-1-ylidene)methyl]-trimethylsilane |
| SMILES | CC1=C/C(=C\[Si](C)(C)C)CC(C)C1 |
| InChI | InChI=1S/C12H22Si/c1-10-6-11(2)8-12(7-10)9-13(3,4)5/h7,9,11H,6,8H2,1-5H3/b12-9+ |
| InChIKey | IZIDKHAUYODDCS-FMIVXFBMSA-N |
| XLogP | 4.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.39 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|