C25H48Si — CID 134982296
[(3E,5E)-2-(cyclohexylmethyl)pentadeca-3,5-dienyl]-trimethylsilane (PubChem CID 134982296) has the molecular formula C25H48Si and a molecular weight of 376.75 g/mol. Its IUPAC name is [(3E,5E)-2-(cyclohexylmethyl)pentadeca-3,5-dienyl]-trimethylsilane.
| Compound Name | [(3E,5E)-2-(cyclohexylmethyl)pentadeca-3,5-dienyl]-trimethylsilane |
|---|---|
| PubChem CID | 134982296 |
| Molecular Formula | C25H48Si |
| Molecular Weight | 376.75 g/mol |
| Exact Mass | 376.35 |
| IUPAC Name | [(3E,5E)-2-(cyclohexylmethyl)pentadeca-3,5-dienyl]-trimethylsilane |
| SMILES | CCCCCCCCC/C=C/C=C/C(CC1CCCCC1)C[Si](C)(C)C |
| InChI | InChI=1S/C25H48Si/c1-5-6-7-8-9-10-11-12-13-14-16-21-25(23-26(2,3)4)22-24-19-17-15-18-20-24/h13-14,16,21,24-25H,5-12,15,17-20,22-23H2,1-4H3/b14-13+,21-16+ |
| InChIKey | ZOKSMVZTQBKDSV-VXUIJSMJSA-N |
| XLogP | 9.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.75 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|