C16H30Si2 — CID 11119434
[(1S,8aR)-4-trimethylsilyl-1,5,6,7,8,8a-hexahydronaphthalen-1-yl]-trimethylsilane (PubChem CID 11119434) has the molecular formula C16H30Si2 and a molecular weight of 278.59 g/mol. Its IUPAC name is [(1S,8aR)-4-trimethylsilyl-1,5,6,7,8,8a-hexahydronaphthalen-1-yl]-trimethylsilane.
| Compound Name | [(1S,8aR)-4-trimethylsilyl-1,5,6,7,8,8a-hexahydronaphthalen-1-yl]-trimethylsilane |
|---|---|
| PubChem CID | 11119434 |
| Molecular Formula | C16H30Si2 |
| Molecular Weight | 278.59 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | [(1S,8aR)-4-trimethylsilyl-1,5,6,7,8,8a-hexahydronaphthalen-1-yl]-trimethylsilane |
| SMILES | C[Si](C)(C)C1=C2CCCC[C@H]2[C@@H]([Si](C)(C)C)C=C1 |
| InChI | InChI=1S/C16H30Si2/c1-17(2,3)15-11-12-16(18(4,5)6)14-10-8-7-9-13(14)15/h11-13,15H,7-10H2,1-6H3/t13-,15+/m1/s1 |
| InChIKey | RKGMAGOQUMLTBV-HIFRSBDPSA-N |
| XLogP | 5.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.59 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|