C18H36Si — CID 10779163
[(E)-4-cyclohexyl-2,3-dimethylbut-2-enyl]-triethylsilane (PubChem CID 10779163) has the molecular formula C18H36Si and a molecular weight of 280.57 g/mol. Its IUPAC name is [(E)-4-cyclohexyl-2,3-dimethylbut-2-enyl]-triethylsilane.
| Compound Name | [(E)-4-cyclohexyl-2,3-dimethylbut-2-enyl]-triethylsilane |
|---|---|
| PubChem CID | 10779163 |
| Molecular Formula | C18H36Si |
| Molecular Weight | 280.57 g/mol |
| Exact Mass | 280.26 |
| IUPAC Name | [(E)-4-cyclohexyl-2,3-dimethylbut-2-enyl]-triethylsilane |
| SMILES | CC[Si](CC)(CC)C/C(C)=C(\C)CC1CCCCC1 |
| InChI | InChI=1S/C18H36Si/c1-6-19(7-2,8-3)15-17(5)16(4)14-18-12-10-9-11-13-18/h18H,6-15H2,1-5H3/b17-16+ |
| InChIKey | LUNPWBVPZMQHBG-WUKNDPDISA-N |
| XLogP | 6.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.57 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|