C17H28Si — CID 164685517
trimethyl-[1-[(1R,5S)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl]buta-2,3-dien-2-yl]silane (PubChem CID 164685517) has the molecular formula C17H28Si and a molecular weight of 260.50 g/mol. Its IUPAC name is trimethyl-[1-[(1R,5S)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl]buta-2,3-dien-2-yl]silane.
| Compound Name | trimethyl-[1-[(1R,5S)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl]buta-2,3-dien-2-yl]silane |
|---|---|
| PubChem CID | 164685517 |
| Molecular Formula | C17H28Si |
| Molecular Weight | 260.50 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | trimethyl-[1-[(1R,5S)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl]buta-2,3-dien-2-yl]silane |
| SMILES | C=C=C(C[C@H]1C[C@@H](C(=C)C)CC=C1C)[Si](C)(C)C |
| InChI | InChI=1S/C17H28Si/c1-8-17(18(5,6)7)12-16-11-15(13(2)3)10-9-14(16)4/h9,15-16H,1-2,10-12H2,3-7H3/t15-,16+/m0/s1 |
| InChIKey | PBONREKJDOGDHE-JKSUJKDBSA-N |
| XLogP | 5.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.50 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|