C16H22Si — CID 11085963
trimethyl-[4-[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]buta-1,3-diynyl]silane (PubChem CID 11085963) has the molecular formula C16H22Si and a molecular weight of 242.44 g/mol. Its IUPAC name is trimethyl-[4-[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]buta-1,3-diynyl]silane.
| Compound Name | trimethyl-[4-[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]buta-1,3-diynyl]silane |
|---|---|
| PubChem CID | 11085963 |
| Molecular Formula | C16H22Si |
| Molecular Weight | 242.44 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | trimethyl-[4-[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]buta-1,3-diynyl]silane |
| SMILES | C=C(C)[C@@H]1CC=C(C#CC#C[Si](C)(C)C)CC1 |
| InChI | InChI=1S/C16H22Si/c1-14(2)16-11-9-15(10-12-16)8-6-7-13-17(3,4)5/h9,16H,1,10-12H2,2-5H3/t16-/m1/s1 |
| InChIKey | IOIDJDFUUTUCKD-MRXNPFEDSA-N |
| XLogP | 4.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.44 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|