C20H36Si2 — CID 134832827
[(4aR,9aS)-10-trimethylsilyl-1,2,3,4,4a,5,6,7,8,9a-decahydroanthracen-9-yl]-trimethylsilane (PubChem CID 134832827) has the molecular formula C20H36Si2 and a molecular weight of 332.68 g/mol. Its IUPAC name is [(4aR,9aS)-10-trimethylsilyl-1,2,3,4,4a,5,6,7,8,9a-decahydroanthracen-9-yl]-trimethylsilane.
| Compound Name | [(4aR,9aS)-10-trimethylsilyl-1,2,3,4,4a,5,6,7,8,9a-decahydroanthracen-9-yl]-trimethylsilane |
|---|---|
| PubChem CID | 134832827 |
| Molecular Formula | C20H36Si2 |
| Molecular Weight | 332.68 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | [(4aR,9aS)-10-trimethylsilyl-1,2,3,4,4a,5,6,7,8,9a-decahydroanthracen-9-yl]-trimethylsilane |
| SMILES | C[Si](C)(C)C1=C2CCCCC2=C([Si](C)(C)C)[C@@H]2CCCC[C@H]12 |
| InChI | InChI=1S/C20H36Si2/c1-21(2,3)19-15-11-7-9-13-17(15)20(22(4,5)6)18-14-10-8-12-16(18)19/h15,17H,7-14H2,1-6H3/t15-,17+ |
| InChIKey | UZSIWGNJYSEBFC-WOVMCDHWSA-N |
| XLogP | 6.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.68 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|