C17H28Si — CID 13273621
[(10aR)-1,2,3,4,5,6,7,8,10,10a-decahydrophenanthren-9-yl]-trimethylsilane (PubChem CID 13273621) has the molecular formula C17H28Si and a molecular weight of 260.50 g/mol. Its IUPAC name is [(10aR)-1,2,3,4,5,6,7,8,10,10a-decahydrophenanthren-9-yl]-trimethylsilane.
| Compound Name | [(10aR)-1,2,3,4,5,6,7,8,10,10a-decahydrophenanthren-9-yl]-trimethylsilane |
|---|---|
| PubChem CID | 13273621 |
| Molecular Formula | C17H28Si |
| Molecular Weight | 260.50 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | [(10aR)-1,2,3,4,5,6,7,8,10,10a-decahydrophenanthren-9-yl]-trimethylsilane |
| SMILES | C[Si](C)(C)C1=C2CCCCC2=C2CCCC[C@@H]2C1 |
| InChI | InChI=1S/C17H28Si/c1-18(2,3)17-12-13-8-4-5-9-14(13)15-10-6-7-11-16(15)17/h13H,4-12H2,1-3H3/t13-/m1/s1 |
| InChIKey | MHVRHWVKESVSHI-CYBMUJFWSA-N |
| XLogP | 5.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.50 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|