C18H30Si — CID 172555604
[5-(3-cyclohexylpropylidene)cyclohexa-1,3-dien-1-yl]-trimethylsilane (PubChem CID 172555604) has the molecular formula C18H30Si and a molecular weight of 274.52 g/mol. Its IUPAC name is [5-(3-cyclohexylpropylidene)cyclohexa-1,3-dien-1-yl]-trimethylsilane.
| Compound Name | [5-(3-cyclohexylpropylidene)cyclohexa-1,3-dien-1-yl]-trimethylsilane |
|---|---|
| PubChem CID | 172555604 |
| Molecular Formula | C18H30Si |
| Molecular Weight | 274.52 g/mol |
| Exact Mass | 274.21 |
| IUPAC Name | [5-(3-cyclohexylpropylidene)cyclohexa-1,3-dien-1-yl]-trimethylsilane |
| SMILES | C[Si](C)(C)C1=CC=CC(=CCCC2CCCCC2)C1 |
| InChI | InChI=1S/C18H30Si/c1-19(2,3)18-14-8-13-17(15-18)12-7-11-16-9-5-4-6-10-16/h8,12-14,16H,4-7,9-11,15H2,1-3H3 |
| InChIKey | QSJLQJNFSQYFPF-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.52 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|