C20H39F3Si — CID 139683805
trifluoro-[(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl]silane (PubChem CID 139683805) has the molecular formula C20H39F3Si and a molecular weight of 364.61 g/mol. Its IUPAC name is trifluoro-[(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl]silane.
| Compound Name | trifluoro-[(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl]silane |
|---|---|
| PubChem CID | 139683805 |
| Molecular Formula | C20H39F3Si |
| Molecular Weight | 364.61 g/mol |
| Exact Mass | 364.28 |
| IUPAC Name | trifluoro-[(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl]silane |
| SMILES | C/C(=C\C[Si](F)(F)F)CCC[C@H](C)CCC[C@H](C)CCCC(C)C |
| InChI | InChI=1S/C20H39F3Si/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-14-20(5)15-16-24(21,22)23/h15,17-19H,6-14,16H2,1-5H3/b20-15+/t18-,19-/m1/s1 |
| InChIKey | VZTGJONMKICLFS-PYDDKJGSSA-N |
| XLogP | 8.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.61 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|