C19H35ISi — CID 162411213
tert-butyl-[(3R,4R)-3-(2-iodoethyl)-4,8-dimethylnon-7-en-1-ynyl]-dimethylsilane (PubChem CID 162411213) has the molecular formula C19H35ISi and a molecular weight of 418.48 g/mol. Its IUPAC name is tert-butyl-[(3R,4R)-3-(2-iodoethyl)-4,8-dimethylnon-7-en-1-ynyl]-dimethylsilane.
| Compound Name | tert-butyl-[(3R,4R)-3-(2-iodoethyl)-4,8-dimethylnon-7-en-1-ynyl]-dimethylsilane |
|---|---|
| PubChem CID | 162411213 |
| Molecular Formula | C19H35ISi |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | tert-butyl-[(3R,4R)-3-(2-iodoethyl)-4,8-dimethylnon-7-en-1-ynyl]-dimethylsilane |
| SMILES | CC(C)=CCC[C@@H](C)[C@H](C#C[Si](C)(C)C(C)(C)C)CCI |
| InChI | InChI=1S/C19H35ISi/c1-16(2)10-9-11-17(3)18(12-14-20)13-15-21(7,8)19(4,5)6/h10,17-18H,9,11-12,14H2,1-8H3/t17-,18+/m1/s1 |
| InChIKey | PSQKOVCNORLDFQ-MSOLQXFVSA-N |
| XLogP | 6.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|