C15H28Si — CID 10728541
[(5R)-5,9-dimethyldec-8-en-1-ynyl]-trimethylsilane (PubChem CID 10728541) has the molecular formula C15H28Si and a molecular weight of 236.47 g/mol. Its IUPAC name is [(5R)-5,9-dimethyldec-8-en-1-ynyl]-trimethylsilane.
| Compound Name | [(5R)-5,9-dimethyldec-8-en-1-ynyl]-trimethylsilane |
|---|---|
| PubChem CID | 10728541 |
| Molecular Formula | C15H28Si |
| Molecular Weight | 236.47 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | [(5R)-5,9-dimethyldec-8-en-1-ynyl]-trimethylsilane |
| SMILES | CC(C)=CCC[C@@H](C)CCC#C[Si](C)(C)C |
| InChI | InChI=1S/C15H28Si/c1-14(2)10-9-12-15(3)11-7-8-13-16(4,5)6/h10,15H,7,9,11-12H2,1-6H3/t15-/m0/s1 |
| InChIKey | MKEPDXBQCFZVCO-HNNXBMFYSA-N |
| XLogP | 5.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.47 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|