C18H36Si2 — CID 10566787
[(5R)-5,9-dimethyl-1-trimethylsilyldec-8-en-1-yn-3-yl]-trimethylsilane (PubChem CID 10566787) has the molecular formula C18H36Si2 and a molecular weight of 308.66 g/mol. Its IUPAC name is [(5R)-5,9-dimethyl-1-trimethylsilyldec-8-en-1-yn-3-yl]-trimethylsilane.
| Compound Name | [(5R)-5,9-dimethyl-1-trimethylsilyldec-8-en-1-yn-3-yl]-trimethylsilane |
|---|---|
| PubChem CID | 10566787 |
| Molecular Formula | C18H36Si2 |
| Molecular Weight | 308.66 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | [(5R)-5,9-dimethyl-1-trimethylsilyldec-8-en-1-yn-3-yl]-trimethylsilane |
| SMILES | CC(C)=CCC[C@@H](C)CC(C#C[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C18H36Si2/c1-16(2)11-10-12-17(3)15-18(20(7,8)9)13-14-19(4,5)6/h11,17-18H,10,12,15H2,1-9H3/t17-,18?/m1/s1 |
| InChIKey | HWEAMXUMYDKMCZ-QNSVNVJESA-N |
| XLogP | 6.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.66 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|