About [(5R)-5,9-dimethyl-1-trimethylsilyldec-8-en-1-yn-3-yl]-trimethylsilane
[(5R)-5,9-dimethyl-1-trimethylsilyldec-8-en-1-yn-3-yl]-trimethylsilane (PubChem CID 10566787) has the molecular formula C18H36Si2
and a molecular weight of 308.66 g/mol. Its IUPAC name is [(5R)-5,9-dimethyl-1-trimethylsilyldec-8-en-1-yn-3-yl]-trimethylsilane.
Molecular Properties
| Compound Name | [(5R)-5,9-dimethyl-1-trimethylsilyldec-8-en-1-yn-3-yl]-trimethylsilane |
| PubChem CID | 10566787 |
| Molecular Formula | C18H36Si2 |
| Molecular Weight | 308.66 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | [(5R)-5,9-dimethyl-1-trimethylsilyldec-8-en-1-yn-3-yl]-trimethylsilane |
| SMILES | CC(C)=CCC[C@@H](C)CC(C#C[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C18H36Si2/c1-16(2)11-10-12-17(3)15-18(20(7,8)9)13-14-19(4,5)6/h11,17-18H,10,12,15H2,1-9H3/t17-,18?/m1/s1 |
| InChIKey | HWEAMXUMYDKMCZ-QNSVNVJESA-N |
| XLogP | 6.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.66 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [(5R)-5,9-dimethyl-1-trimethylsilyldec-8-en-1-yn-3-yl]-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(5R)-5,9-dimethyl-1-trimethylsilyldec-8-en-1-yn-3-yl]-trimethylsilane?
The IUPAC name of [(5R)-5,9-dimethyl-1-trimethylsilyldec-8-en-1-yn-3-yl]-trimethylsilane (CID 10566787) is [(5R)-5,9-dimethyl-1-trimethylsilyldec-8-en-1-yn-3-yl]-trimethylsilane.
What is the SMILES notation for [(5R)-5,9-dimethyl-1-trimethylsilyldec-8-en-1-yn-3-yl]-trimethylsilane?
The canonical SMILES for [(5R)-5,9-dimethyl-1-trimethylsilyldec-8-en-1-yn-3-yl]-trimethylsilane is CC(C)=CCC[C@@H](C)CC(C#C[Si](C)(C)C)[Si](C)(C)C.
What is the InChIKey of [(5R)-5,9-dimethyl-1-trimethylsilyldec-8-en-1-yn-3-yl]-trimethylsilane?
The InChIKey is HWEAMXUMYDKMCZ-QNSVNVJESA-N. The full InChI is InChI=1S/C18H36Si2/c1-16(2)11-10-12-17(3)15-18(20(7,8)9)13-14-19(4,5)6/h11,17-18H,10,12,15H2,1-9H3/t17-,18?/m1/s1.
What are the key properties of [(5R)-5,9-dimethyl-1-trimethylsilyldec-8-en-1-yn-3-yl]-trimethylsilane?
[(5R)-5,9-dimethyl-1-trimethylsilyldec-8-en-1-yn-3-yl]-trimethylsilane has a molecular weight of 308.66 g/mol, XLogP of 6.35, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(5R)-5,9-dimethyl-1-trimethylsilyldec-8-en-1-yn-3-yl]-trimethylsilane is sourced from PubChem (CID 10566787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).