C31H60Si — CID 140820995
tri(propan-2-yl)-(5,9,13,17-tetramethyloctadec-4-en-1-ynyl)silane (PubChem CID 140820995) has the molecular formula C31H60Si and a molecular weight of 460.91 g/mol. Its IUPAC name is tri(propan-2-yl)-(5,9,13,17-tetramethyloctadec-4-en-1-ynyl)silane.
| Compound Name | tri(propan-2-yl)-(5,9,13,17-tetramethyloctadec-4-en-1-ynyl)silane |
|---|---|
| PubChem CID | 140820995 |
| Molecular Formula | C31H60Si |
| Molecular Weight | 460.91 g/mol |
| Exact Mass | 460.45 |
| IUPAC Name | tri(propan-2-yl)-(5,9,13,17-tetramethyloctadec-4-en-1-ynyl)silane |
| SMILES | CC(=CCC#C[Si](C(C)C)(C(C)C)C(C)C)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C31H60Si/c1-25(2)17-14-19-30(10)21-16-23-31(11)22-15-20-29(9)18-12-13-24-32(26(3)4,27(5)6)28(7)8/h18,25-28,30-31H,12,14-17,19-23H2,1-11H3 |
| InChIKey | KUBKAGLNRGIQNS-UHFFFAOYSA-N |
| XLogP | 10.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.91 |
| LogP ≤ 5 | 10.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|