C29H48OSi2 — CID 135064806
(3R)-1-(4-tert-butylcyclohexen-1-yl)-3-(2-trimethylsilylethynyl)-5-tri(propan-2-yl)silylpenta-1,4-diyn-3-ol (PubChem CID 135064806) has the molecular formula C29H48OSi2 and a molecular weight of 468.87 g/mol. Its IUPAC name is (3R)-1-(4-tert-butylcyclohexen-1-yl)-3-(2-trimethylsilylethynyl)-5-tri(propan-2-yl)silylpenta-1,4-diyn-3-ol.
| Compound Name | (3R)-1-(4-tert-butylcyclohexen-1-yl)-3-(2-trimethylsilylethynyl)-5-tri(propan-2-yl)silylpenta-1,4-diyn-3-ol |
|---|---|
| PubChem CID | 135064806 |
| Molecular Formula | C29H48OSi2 |
| Molecular Weight | 468.87 g/mol |
| Exact Mass | 468.32 |
| IUPAC Name | (3R)-1-(4-tert-butylcyclohexen-1-yl)-3-(2-trimethylsilylethynyl)-5-tri(propan-2-yl)silylpenta-1,4-diyn-3-ol |
| SMILES | CC(C)[Si](C#C[C@@](O)(C#CC1=CCC(C(C)(C)C)CC1)C#C[Si](C)(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C29H48OSi2/c1-23(2)32(24(3)4,25(5)6)22-20-29(30,19-21-31(10,11)12)18-17-26-13-15-27(16-14-26)28(7,8)9/h13,23-25,27,30H,14-16H2,1-12H3/t27?,29-/m1/s1 |
| InChIKey | LAEMSARKRBYJJW-ZBAATNBSSA-N |
| XLogP | 7.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.87 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|