C18H41Si4 — CID 100919816
CID 100919816 (PubChem CID 100919816) has the molecular formula C18H41Si4 and a molecular weight of 369.87 g/mol.
| Compound Name | CID 100919816 |
|---|---|
| PubChem CID | 100919816 |
| Molecular Formula | C18H41Si4 |
| Molecular Weight | 369.87 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | — |
| SMILES | CC1=C[C]([Si]([Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C)CC(C)(C)C1 |
| InChI | InChI=1S/C18H41Si4/c1-16-13-17(15-18(2,3)14-16)22(19(4,5)6,20(7,8)9)21(10,11)12/h13H,14-15H2,1-12H3 |
| InChIKey | OGBRJMJNKQXBOG-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.87 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|