C11H22Si — CID 12668514
(4,4-dimethylcyclohexen-1-yl)-trimethylsilane (PubChem CID 12668514) has the molecular formula C11H22Si and a molecular weight of 182.38 g/mol. Its IUPAC name is (4,4-dimethylcyclohexen-1-yl)-trimethylsilane.
| Compound Name | (4,4-dimethylcyclohexen-1-yl)-trimethylsilane |
|---|---|
| PubChem CID | 12668514 |
| Molecular Formula | C11H22Si |
| Molecular Weight | 182.38 g/mol |
| Exact Mass | 182.15 |
| IUPAC Name | (4,4-dimethylcyclohexen-1-yl)-trimethylsilane |
| SMILES | CC1(C)CC=C([Si](C)(C)C)CC1 |
| InChI | InChI=1S/C11H22Si/c1-11(2)8-6-10(7-9-11)12(3,4)5/h6H,7-9H2,1-5H3 |
| InChIKey | OIRPQZWNNKQPNI-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.38 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|