C15H22 — CID 171080974
4-methylcyclopenta-1,2,4-triene;1,4,4-trimethylcyclohexene (PubChem CID 171080974) has the molecular formula C15H22 and a molecular weight of 202.34 g/mol. Its IUPAC name is 4-methylcyclopenta-1,2,4-triene;1,4,4-trimethylcyclohexene.
| Compound Name | 4-methylcyclopenta-1,2,4-triene;1,4,4-trimethylcyclohexene |
|---|---|
| PubChem CID | 171080974 |
| Molecular Formula | C15H22 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | 4-methylcyclopenta-1,2,4-triene;1,4,4-trimethylcyclohexene |
| SMILES | CC1=CC=C=C1.CC1=CCC(C)(C)CC1 |
| InChI | InChI=1S/C9H16.C6H6/c1-8-4-6-9(2,3)7-5-8;1-6-4-2-3-5-6/h4H,5-7H2,1-3H3;2,4-5H,1H3 |
| InChIKey | GKPVAYJOIHDOGK-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|