C14H22O — CID 135017310
1,5,9-trimethylspiro[5.5]undeca-3,9-dien-5-ol (PubChem CID 135017310) has the molecular formula C14H22O and a molecular weight of 206.33 g/mol. Its IUPAC name is 1,5,9-trimethylspiro[5.5]undeca-3,9-dien-5-ol.
| Compound Name | 1,5,9-trimethylspiro[5.5]undeca-3,9-dien-5-ol |
|---|---|
| PubChem CID | 135017310 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | 1,5,9-trimethylspiro[5.5]undeca-3,9-dien-5-ol |
| SMILES | CC1=CCC2(CC1)C(C)CC=CC2(C)O |
| InChI | InChI=1S/C14H22O/c1-11-6-9-14(10-7-11)12(2)5-4-8-13(14,3)15/h4,6,8,12,15H,5,7,9-10H2,1-3H3 |
| InChIKey | DBASZLXAQGEFAT-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|