C16H28Si — CID 139775018
[(2R)-4-[(1R)-2,2-dimethyl-6-methylidenecyclohexyl]but-3-yn-2-yl]-trimethylsilane (PubChem CID 139775018) has the molecular formula C16H28Si and a molecular weight of 248.49 g/mol. Its IUPAC name is [(2R)-4-[(1R)-2,2-dimethyl-6-methylidenecyclohexyl]but-3-yn-2-yl]-trimethylsilane.
| Compound Name | [(2R)-4-[(1R)-2,2-dimethyl-6-methylidenecyclohexyl]but-3-yn-2-yl]-trimethylsilane |
|---|---|
| PubChem CID | 139775018 |
| Molecular Formula | C16H28Si |
| Molecular Weight | 248.49 g/mol |
| Exact Mass | 248.20 |
| IUPAC Name | [(2R)-4-[(1R)-2,2-dimethyl-6-methylidenecyclohexyl]but-3-yn-2-yl]-trimethylsilane |
| SMILES | C=C1CCCC(C)(C)[C@H]1C#C[C@@H](C)[Si](C)(C)C |
| InChI | InChI=1S/C16H28Si/c1-13-9-8-12-16(3,4)15(13)11-10-14(2)17(5,6)7/h14-15H,1,8-9,12H2,2-7H3/t14-,15+/m1/s1 |
| InChIKey | GTQJBOKOLPCXKU-CABCVRRESA-N |
| XLogP | 5.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.49 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|