C16H28Si — CID 14563320
4-(2,2-dimethyl-6-methylidenecyclohexyl)but-1-ynyl-trimethylsilane (PubChem CID 14563320) has the molecular formula C16H28Si and a molecular weight of 248.49 g/mol. Its IUPAC name is 4-(2,2-dimethyl-6-methylidenecyclohexyl)but-1-ynyl-trimethylsilane.
| Compound Name | 4-(2,2-dimethyl-6-methylidenecyclohexyl)but-1-ynyl-trimethylsilane |
|---|---|
| PubChem CID | 14563320 |
| Molecular Formula | C16H28Si |
| Molecular Weight | 248.49 g/mol |
| Exact Mass | 248.20 |
| IUPAC Name | 4-(2,2-dimethyl-6-methylidenecyclohexyl)but-1-ynyl-trimethylsilane |
| SMILES | C=C1CCCC(C)(C)C1CCC#C[Si](C)(C)C |
| InChI | InChI=1S/C16H28Si/c1-14-10-9-12-16(2,3)15(14)11-7-8-13-17(4,5)6/h15H,1,7,9-12H2,2-6H3 |
| InChIKey | SASFUVXYLIPOIO-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.49 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|