C17H28Br2Si — CID 140681351
2-[(1R,2R)-2-(2,2-dibromoethenyl)-1-methylcyclohexyl]ethynyl-triethylsilane (PubChem CID 140681351) has the molecular formula C17H28Br2Si and a molecular weight of 420.31 g/mol. Its IUPAC name is 2-[(1R,2R)-2-(2,2-dibromoethenyl)-1-methylcyclohexyl]ethynyl-triethylsilane.
| Compound Name | 2-[(1R,2R)-2-(2,2-dibromoethenyl)-1-methylcyclohexyl]ethynyl-triethylsilane |
|---|---|
| PubChem CID | 140681351 |
| Molecular Formula | C17H28Br2Si |
| Molecular Weight | 420.31 g/mol |
| Exact Mass | 418.03 |
| IUPAC Name | 2-[(1R,2R)-2-(2,2-dibromoethenyl)-1-methylcyclohexyl]ethynyl-triethylsilane |
| SMILES | CC[Si](C#C[C@]1(C)CCCC[C@@H]1C=C(Br)Br)(CC)CC |
| InChI | InChI=1S/C17H28Br2Si/c1-5-20(6-2,7-3)13-12-17(4)11-9-8-10-15(17)14-16(18)19/h14-15H,5-11H2,1-4H3/t15-,17+/m1/s1 |
| InChIKey | MTPKODFODKLWRQ-WBVHZDCISA-N |
| XLogP | 6.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.31 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|