C12H16Br2 — CID 118261073
trans-(1R,2R)-2-(2,2-dibromoethenyl)-1-methyl-1-prop-1-ynylcyclohexane (PubChem CID 118261073) has the molecular formula C12H16Br2 and a molecular weight of 320.06 g/mol. Its IUPAC name is trans-(1R,2R)-2-(2,2-dibromoethenyl)-1-methyl-1-prop-1-ynylcyclohexane.
| Compound Name | trans-(1R,2R)-2-(2,2-dibromoethenyl)-1-methyl-1-prop-1-ynylcyclohexane |
|---|---|
| PubChem CID | 118261073 |
| Molecular Formula | C12H16Br2 |
| Molecular Weight | 320.06 g/mol |
| Exact Mass | 319.96 |
| IUPAC Name | trans-(1R,2R)-2-(2,2-dibromoethenyl)-1-methyl-1-prop-1-ynylcyclohexane |
| SMILES | CC#C[C@@]1(CCCC[C@@H]1C=C(Br)Br)C |
| InChI | InChI=1S/C12H16Br2/c1-3-7-12(2)8-5-4-6-10(12)9-11(13)14/h9-10H,4-6,8H2,1-2H3/t10-,12-/m1/s1 |
| InChIKey | JIJPXZRLXAWNAQ-ZYHUDNBSSA-N |
| XLogP | 5.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | 288 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.06 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|