C20H34Si — CID 44520658
5-[(1S,5S)-5-tert-butyl-2-ethenylidenecyclohexyl]pent-1-ynyl-trimethylsilane (PubChem CID 44520658) has the molecular formula C20H34Si and a molecular weight of 302.58 g/mol. Its IUPAC name is 5-[(1S,5S)-5-tert-butyl-2-ethenylidenecyclohexyl]pent-1-ynyl-trimethylsilane.
| Compound Name | 5-[(1S,5S)-5-tert-butyl-2-ethenylidenecyclohexyl]pent-1-ynyl-trimethylsilane |
|---|---|
| PubChem CID | 44520658 |
| Molecular Formula | C20H34Si |
| Molecular Weight | 302.58 g/mol |
| Exact Mass | 302.24 |
| IUPAC Name | 5-[(1S,5S)-5-tert-butyl-2-ethenylidenecyclohexyl]pent-1-ynyl-trimethylsilane |
| SMILES | C=C=C1CC[C@H](C(C)(C)C)C[C@@H]1CCCC#C[Si](C)(C)C |
| InChI | InChI=1S/C20H34Si/c1-8-17-13-14-19(20(2,3)4)16-18(17)12-10-9-11-15-21(5,6)7/h18-19H,1,9-10,12-14,16H2,2-7H3/t18-,19-/m0/s1 |
| InChIKey | CNXYYXPFFRFKGL-OALUTQOASA-N |
| XLogP | 6.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.58 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|