C21H38Si — CID 102235452
(4-cyclohexyl-3-methylidenepent-1-ynyl)-tri(propan-2-yl)silane (PubChem CID 102235452) has the molecular formula C21H38Si and a molecular weight of 318.62 g/mol. Its IUPAC name is (4-cyclohexyl-3-methylidenepent-1-ynyl)-tri(propan-2-yl)silane.
| Compound Name | (4-cyclohexyl-3-methylidenepent-1-ynyl)-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 102235452 |
| Molecular Formula | C21H38Si |
| Molecular Weight | 318.62 g/mol |
| Exact Mass | 318.27 |
| IUPAC Name | (4-cyclohexyl-3-methylidenepent-1-ynyl)-tri(propan-2-yl)silane |
| SMILES | C=C(C#C[Si](C(C)C)(C(C)C)C(C)C)C(C)C1CCCCC1 |
| InChI | InChI=1S/C21H38Si/c1-16(2)22(17(3)4,18(5)6)15-14-19(7)20(8)21-12-10-9-11-13-21/h16-18,20-21H,7,9-13H2,1-6,8H3 |
| InChIKey | LYDNLXLJMUEQIH-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.62 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|