C13H20 — CID 139775017
(2R)-2-but-1-ynyl-1,1-dimethyl-3-methylidenecyclohexane (PubChem CID 139775017) has the molecular formula C13H20 and a molecular weight of 176.30 g/mol. Its IUPAC name is (2R)-2-but-1-ynyl-1,1-dimethyl-3-methylidenecyclohexane.
| Compound Name | (2R)-2-but-1-ynyl-1,1-dimethyl-3-methylidenecyclohexane |
|---|---|
| PubChem CID | 139775017 |
| Molecular Formula | C13H20 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.16 |
| IUPAC Name | (2R)-2-but-1-ynyl-1,1-dimethyl-3-methylidenecyclohexane |
| SMILES | C=C1CCCC(C)(C)[C@H]1C#CCC |
| InChI | InChI=1S/C13H20/c1-5-6-9-12-11(2)8-7-10-13(12,3)4/h12H,2,5,7-8,10H2,1,3-4H3/t12-/m0/s1 |
| InChIKey | QJBGLSORQXXACJ-LBPRGKRZSA-N |
| XLogP | 3.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|