C17H32Si — CID 90989259
cyclohexyl-dimethyl-[(1S,4S,5R)-2,3,4,5-tetramethylcyclopent-2-en-1-yl]silane (PubChem CID 90989259) has the molecular formula C17H32Si and a molecular weight of 264.53 g/mol. Its IUPAC name is cyclohexyl-dimethyl-[(1S,4S,5R)-2,3,4,5-tetramethylcyclopent-2-en-1-yl]silane.
| Compound Name | cyclohexyl-dimethyl-[(1S,4S,5R)-2,3,4,5-tetramethylcyclopent-2-en-1-yl]silane |
|---|---|
| PubChem CID | 90989259 |
| Molecular Formula | C17H32Si |
| Molecular Weight | 264.53 g/mol |
| Exact Mass | 264.23 |
| IUPAC Name | cyclohexyl-dimethyl-[(1S,4S,5R)-2,3,4,5-tetramethylcyclopent-2-en-1-yl]silane |
| SMILES | CC1=C(C)[C@@H]([Si](C)(C)C2CCCCC2)[C@H](C)[C@@H]1C |
| InChI | InChI=1S/C17H32Si/c1-12-13(2)15(4)17(14(12)3)18(5,6)16-10-8-7-9-11-16/h12,14,16-17H,7-11H2,1-6H3/t12-,14-,17+/m1/s1 |
| InChIKey | FXDFOHXUDZTIHX-MRRJBJDNSA-N |
| XLogP | 6.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.53 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|