C22H36Si — CID 54417051
dimethyl-bis(2-methyl-3a,4,5,6,7,7a-hexahydro-3H-inden-1-yl)silane (PubChem CID 54417051) has the molecular formula C22H36Si and a molecular weight of 328.62 g/mol. Its IUPAC name is dimethyl-bis(2-methyl-3a,4,5,6,7,7a-hexahydro-3H-inden-1-yl)silane.
| Compound Name | dimethyl-bis(2-methyl-3a,4,5,6,7,7a-hexahydro-3H-inden-1-yl)silane |
|---|---|
| PubChem CID | 54417051 |
| Molecular Formula | C22H36Si |
| Molecular Weight | 328.62 g/mol |
| Exact Mass | 328.26 |
| IUPAC Name | dimethyl-bis(2-methyl-3a,4,5,6,7,7a-hexahydro-3H-inden-1-yl)silane |
| SMILES | CC1=C([Si](C)(C)C2=C(C)CC3CCCCC23)C2CCCCC2C1 |
| InChI | InChI=1S/C22H36Si/c1-15-13-17-9-5-7-11-19(17)21(15)23(3,4)22-16(2)14-18-10-6-8-12-20(18)22/h17-20H,5-14H2,1-4H3 |
| InChIKey | VYEPUWTXUDBBLP-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.62 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|