C26H42Si — CID 59957883
[(3aS)-3a,4,5,6,7,7a-hexahydro-1H-inden-1-yl]-(3a,4,5,6,7,7a-hexahydro-1H-inden-1-yl)-(2-cyclopentylethyl)-methylsilane (PubChem CID 59957883) has the molecular formula C26H42Si and a molecular weight of 382.71 g/mol. Its IUPAC name is [(3aS)-3a,4,5,6,7,7a-hexahydro-1H-inden-1-yl]-(3a,4,5,6,7,7a-hexahydro-1H-inden-1-yl)-(2-cyclopentylethyl)-methylsilane.
| Compound Name | [(3aS)-3a,4,5,6,7,7a-hexahydro-1H-inden-1-yl]-(3a,4,5,6,7,7a-hexahydro-1H-inden-1-yl)-(2-cyclopentylethyl)-methylsilane |
|---|---|
| PubChem CID | 59957883 |
| Molecular Formula | C26H42Si |
| Molecular Weight | 382.71 g/mol |
| Exact Mass | 382.31 |
| IUPAC Name | [(3aS)-3a,4,5,6,7,7a-hexahydro-1H-inden-1-yl]-(3a,4,5,6,7,7a-hexahydro-1H-inden-1-yl)-(2-cyclopentylethyl)-methylsilane |
| SMILES | C[Si](CCC1CCCC1)(C1C=CC2CCCCC21)C1C=C[C@@H]2CCCCC12 |
| InChI | InChI=1S/C26H42Si/c1-27(19-18-20-8-2-3-9-20,25-16-14-21-10-4-6-12-23(21)25)26-17-15-22-11-5-7-13-24(22)26/h14-17,20-26H,2-13,18-19H2,1H3/t21-,22?,23?,24?,25?,26?,27?/m0/s1 |
| InChIKey | OYLOHBCNIFSGRX-CANLUVOMSA-N |
| XLogP | 8.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.71 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|