C19H38Si3 — CID 123200834
tert-butyl-dimethyl-[(3-trimethylsilyl-2-tricyclo[3.3.1.13,7]dec-1-enyl)silyl]silane (PubChem CID 123200834) has the molecular formula C19H38Si3 and a molecular weight of 350.77 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(3-trimethylsilyl-2-tricyclo[3.3.1.13,7]dec-1-enyl)silyl]silane.
| Compound Name | tert-butyl-dimethyl-[(3-trimethylsilyl-2-tricyclo[3.3.1.13,7]dec-1-enyl)silyl]silane |
|---|---|
| PubChem CID | 123200834 |
| Molecular Formula | C19H38Si3 |
| Molecular Weight | 350.77 g/mol |
| Exact Mass | 350.23 |
| IUPAC Name | tert-butyl-dimethyl-[(3-trimethylsilyl-2-tricyclo[3.3.1.13,7]dec-1-enyl)silyl]silane |
| SMILES | CC(C)(C)[Si](C)(C)[SiH2]C1=C2CC3CC(C2)CC1([Si](C)(C)C)C3 |
| InChI | InChI=1S/C19H38Si3/c1-18(2,3)22(7,8)20-17-16-10-14-9-15(11-16)13-19(17,12-14)21(4,5)6/h14-15H,9-13,20H2,1-8H3 |
| InChIKey | YJGBXHHTVCFKGM-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.77 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|