C30H40Si — CID 10094115
2-(15-heptacyclo[15.2.2.24,7.210,13.02,16.03,8.09,14]pentacosa-2(16),3(8),9(14)-trienyl)ethynyl-trimethylsilane (PubChem CID 10094115) has the molecular formula C30H40Si and a molecular weight of 428.74 g/mol. Its IUPAC name is 2-(15-heptacyclo[15.2.2.24,7.210,13.02,16.03,8.09,14]pentacosa-2(16),3(8),9(14)-trienyl)ethynyl-trimethylsilane.
| Compound Name | 2-(15-heptacyclo[15.2.2.24,7.210,13.02,16.03,8.09,14]pentacosa-2(16),3(8),9(14)-trienyl)ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 10094115 |
| Molecular Formula | C30H40Si |
| Molecular Weight | 428.74 g/mol |
| Exact Mass | 428.29 |
| IUPAC Name | 2-(15-heptacyclo[15.2.2.24,7.210,13.02,16.03,8.09,14]pentacosa-2(16),3(8),9(14)-trienyl)ethynyl-trimethylsilane |
| SMILES | C[Si](C)(C)C#CC1C2=C(C3=C(C4=C1C1CCC4CC1)C1CCC3CC1)C1CCC2CC1 |
| InChI | InChI=1S/C30H40Si/c1-31(2,3)17-16-24-25-18-4-8-20(9-5-18)27(25)29-22-12-14-23(15-13-22)30(29)28-21-10-6-19(7-11-21)26(24)28/h18-24H,4-15H2,1-3H3 |
| InChIKey | OZDLZEAHRUCMNM-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.74 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|