C18H26Si — CID 102573860
9,9-dimethyl-9-silapentacyclo[9.2.2.24,7.02,10.03,8]heptadeca-2(10),3(8)-diene (PubChem CID 102573860) has the molecular formula C18H26Si and a molecular weight of 270.49 g/mol. Its IUPAC name is 9,9-dimethyl-9-silapentacyclo[9.2.2.24,7.02,10.03,8]heptadeca-2(10),3(8)-diene.
| Compound Name | 9,9-dimethyl-9-silapentacyclo[9.2.2.24,7.02,10.03,8]heptadeca-2(10),3(8)-diene |
|---|---|
| PubChem CID | 102573860 |
| Molecular Formula | C18H26Si |
| Molecular Weight | 270.49 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 9,9-dimethyl-9-silapentacyclo[9.2.2.24,7.02,10.03,8]heptadeca-2(10),3(8)-diene |
| SMILES | C[Si]1(C)C2=C(C3=C1C1CCC3CC1)C1CCC2CC1 |
| InChI | InChI=1S/C18H26Si/c1-19(2)17-13-7-3-11(4-8-13)15(17)16-12-5-9-14(10-6-12)18(16)19/h11-14H,3-10H2,1-2H3 |
| InChIKey | LRZNAMJDBOJMDV-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.49 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|